| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Frinton Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| Name | 1,1'-(1,3-Propanediyl)Dibenzene |
|---|---|
| Synonyms | (3-phenylpropyl)benzene; (3-Phenylpropyl)benzene #; 1,1'-(1,3-Propanediyl)bisbenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 |
| CAS Registry Number | 1335-47-3 |
| SMILES | C1=CC=C(C=C1)CCCC2=CC=CC=C2 |
| InChI | 1S/C15H16/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2 |
| InChIKey | VEAFKIYNHVBNIP-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| 0.98 (Expl.) | |
| Boiling point | 300.298°C at 760 mmHg (Cal.) |
| 158-159°C (Expl.) | |
| Flash point | 129.2±9.7°C (Cal.) |
| Refractive index | 1.56 (Expl.) |
| 1.565 (Cal.) | |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| (1) | Michelle K. Kidder, Phillip F. Britt, Zongtao Zhang, Sheng Dai and A. C. Buchanan, III. Pore size effects in the pyrolysis of 1,3-diphenylpropane confined in mesoporous silicas, Chem. Commun., 2003, 0, 2804. |
|---|---|
| Market Analysis Reports |