|
CAS#: 1335-57-5 Product: D-Glucono-1,5-Lactone No suppilers available for the product. |
| Name | D-Glucono-1,5-Lactone |
|---|---|
| Synonyms | (3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)Tetrahydropyran-2-One; (3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)-2-Tetrahydropyranone; (3R,4S,5S,6R)-3,4,5-Trihydroxy-6-Methylol-Tetrahydropyran-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 |
| CAS Registry Number | 1335-57-5 |
| SMILES | [C@H]1([C@H]([C@@H]([C@@H](O)C(O1)=O)O)O)CO |
| InChI | 1S/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-5,7-10H,1H2/t2-,3-,4+,5-/m1/s1 |
| InChIKey | PHOQVHQSTUBQQK-SQOUGZDYSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 153°C (Expl.) |
| Boiling point | 446.4±38.0°C at 760 mmHg (Cal.) |
| Flash point | 192.3±20.3°C (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| Market Analysis Reports |