|
CAS#: 133560-91-5 Product: 2-[3-[3-(Carboxymethyl)Phenyl]Diazenylphenyl]Acetic Acid No suppilers available for the product. |
| Name | 2-[3-[3-(Carboxymethyl)Phenyl]Diazenylphenyl]Acetic Acid |
|---|---|
| Synonyms | 2-[3-[3-(Carboxymethyl)Phenyl]Azophenyl]Acetic Acid; 2-[3-[3-(Carboxymethyl)Phenyl]Diazenylphenyl]Ethanoic Acid; 3,3'-Abba |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 |
| CAS Registry Number | 133560-91-5 |
| SMILES | C2=C(N=NC1=CC(=CC=C1)CC(=O)O)C=CC=C2CC(=O)O |
| InChI | 1S/C16H14N2O4/c19-15(20)9-11-3-1-5-13(7-11)17-18-14-6-2-4-12(8-14)10-16(21)22/h1-8H,9-10H2,(H,19,20)(H,21,22) |
| InChIKey | WBMIICFYKRWOBJ-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 568.457°C at 760 mmHg (Cal.) |
| Flash point | 297.592°C (Cal.) |
| (1) | Gorostiza Pau. Optical switches and triggers for the manipulation of ion channels and pores, Molecular BioSystems, 2007 |
|---|---|
| Market Analysis Reports |