|
CAS#: 1338-32-5 Product: Dimethylazanium 2-Chlorobenzoate No suppilers available for the product. |
| Name | Dimethylazanium 2-Chlorobenzoate |
|---|---|
| Synonyms | 2-Chlorobenzoate; Dimethylammonium; Benzac 354; Dimethylamine Salts Of Mixed Polychlorobenzoic Acids |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 |
| CAS Registry Number | 1338-32-5 |
| SMILES | C1=C(C([O-])=O)C(=CC=C1)Cl.C[NH2+]C |
| InChI | 1S/C7H5ClO2.C2H7N/c8-6-4-2-1-3-5(6)7(9)10;1-3-2/h1-4H,(H,9,10);3H,1-2H3 |
| InChIKey | JLEQUYOQVZXFFW-UHFFFAOYSA-N |
| Boiling point | 275.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 120.5°C (Cal.) |
| Market Analysis Reports |