| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| RIA International LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (973) 581-1282/ | |||
![]() |
marketing@riausa.net,nj@riausa.net | |||
| Chemical distributor | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Salt of carboxylic acid ester and its derivatives |
|---|---|
| Name | Sodium 2-Sulfanylbenzoate |
| Synonyms | Sodium 2-Mercaptobenzoate; 2-Mercapto-Benzoic Acid, Monosodium Salt; C08171 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5NaO2S |
| Molecular Weight | 176.17 |
| CAS Registry Number | 134-23-6 |
| SMILES | C1=CC=CC(=C1C(=O)[O-])S.[Na+] |
| InChI | 1S/C7H6O2S.Na/c8-7(9)5-3-1-2-4-6(5)10;/h1-4,10H,(H,8,9);/q;+1/p-1 |
| InChIKey | HBAIZOJDXAXWHS-UHFFFAOYSA-M |
| Boiling point | 298.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 134.4°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |