|
CAS#: 134576-33-3 Product: 2-Chloroethylphosphonic Acid Hexamethylenetetramine Salt No suppilers available for the product. |
| Name | 2-Chloroethylphosphonic Acid Hexamethylenetetramine Salt |
|---|---|
| Synonyms | Phosphonic Acid, (2-Chloroethyl)-, Compd. With 1,3,5,7-Tetraazatricyclo(3.3.1.1(3,7))Decane(1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C8H18ClN4O3P |
| Molecular Weight | 284.68 |
| CAS Registry Number | 134576-33-3 |
| SMILES | C([P](=O)(O)O)CCl.C1N2CN3CN1CN(C2)C3 |
| InChI | 1S/C6H12N4.C2H6ClO3P/c1-7-2-9-4-8(1)5-10(3-7)6-9;3-1-2-7(4,5)6/h1-6H2;1-2H2,(H2,4,5,6) |
| InChIKey | JOVLMUFEYHPTLF-UHFFFAOYSA-N |
| Boiling point | 252.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 103.9°C (Cal.) |
| Market Analysis Reports |