|
CAS#: 13471-78-8 Product: Beclotiamine No suppilers available for the product. |
| Name | Beclotiamine |
|---|---|
| Synonyms | 5-[[5-(2-Chloroethyl)-4-Methyl-Thiazol-3-Ium-3-Yl]Methyl]-2-Methyl-Pyrimidin-4-Amine Chloride; 5-[[5-(2-Chloroethyl)-4-Methyl-3-Thiazol-3-Iumyl]Methyl]-2-Methyl-4-Pyrimidinamine Chloride; [5-[[5-(2-Chloroethyl)-4-Methyl-Thiazol-3-Ium-3-Yl]Methyl]-2-Methyl-Pyrimidin-4-Yl]Amine Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16Cl2N4S |
| Molecular Weight | 319.25 |
| CAS Registry Number | 13471-78-8 (20166-17-0) |
| SMILES | C1=[N+](C(=C(CCCl)S1)C)CC2=C(N=C(C)N=C2)N.[Cl-] |
| InChI | 1S/C12H16ClN4S.ClH/c1-8-11(3-4-13)18-7-17(8)6-10-5-15-9(2)16-12(10)14;/h5,7H,3-4,6H2,1-2H3,(H2,14,15,16);1H/q+1;/p-1 |
| InChIKey | BPEQAFGUCPPRIB-UHFFFAOYSA-M |
| (1) | Duncan Carmichael, Xavier F. Le Goff and Eric Muller. Studies of how redox chemistry influences the synthesis of transition metal phosphametallocenes: a convenient synthesis of 2,5-diester-substituted phosphametallocenes and 2,2′,5,5′-tetraester-substituted-1,1′-diphosphaferrocenes, New J. Chem., 2010, 34, 1341. |
|---|---|
| Market Analysis Reports |