| Alchem Pharmtech, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (848) 565-5694 | |||
![]() |
sales@alchempharmtech.com | |||
| Chemical manufacturer | ||||
| Aronis | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (926) 578-0336 | |||
![]() |
rakishev@aronis.ru | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Rintech, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (301) 987-1980 | |||
![]() |
info@rintechinc.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-Methoxy-N-(2-Thienylmethylene)-Benzenamine |
|---|---|
| Synonyms | N-(4-Methoxyphenyl)-1-(2-Thienyl)Methanimine; (4-Methoxyphenyl)-(2-Thienylmethylene)Amine; N-(4-Methoxyphenyl)-1-Thiophen-2-Yl-Methanimine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 |
| CAS Registry Number | 13533-27-2 |
| SMILES | C2=C(N=CC1=CC=CS1)C=CC(=C2)OC |
| InChI | 1S/C12H11NOS/c1-14-11-6-4-10(5-7-11)13-9-12-3-2-8-15-12/h2-9H,1H3 |
| InChIKey | ORWHLIROYKRIJT-UHFFFAOYSA-N |
| Density | 1.122g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.779°C at 760 mmHg (Cal.) |
| Flash point | 173.203°C (Cal.) |
| (1) | Adam B. Powell, Jaclyn R. Brown, Kalyan V. Vasudevan and Alan H. Cowley. Facile syntheses of thiophene-substituted 1,4-diazabutadiene (α-diimine) ligands and their conversion to phosphenium triiodide salts, Dalton Trans., 2009, 2521. |
|---|---|
| Market Analysis Reports |