| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Copper Diethylaminomethanedithioate |
|---|---|
| Synonyms | Cupric Diethylaminomethanedithioate; Nsc 1337; Aids-010701 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20CuN2S4 |
| Molecular Weight | 360.07 |
| CAS Registry Number | 13681-87-3 |
| SMILES | C(N(C([S-])=S)CC)C.C(N(C([S-])=S)CC)C.[Cu++] |
| InChI | 1S/2C5H11NS2.Cu/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | OBBCYCYCTJQCCK-UHFFFAOYSA-L |
| Melting point | 197°C (Expl.) |
|---|---|
| Boiling point | 176.4°C at 760 mmHg (Cal.) |
| Flash point | 60.5°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Ilan Jen-La Plante, Tahani W. Zeid, Peidong Yang and Taleb Mokari. Synthesis of metal sulfide nanomaterials via thermal decomposition of single-source precursors, J. Mater. Chem., 2010, 20, 6612. |
|---|---|
| Market Analysis Reports |