| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 3,3'-(3,3,4,4,5,5-Hexafluoro-1-Cyclopentene-1,2-Diyl)Bis(2-Methyl-1-Benzothiophene) |
|---|---|
| Synonyms | 1,2-bis(2-methylbenzothiophen-3-yl)perfluorocyclopentene; 1,2-Bis[2 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H14F6S2 |
| Molecular Weight | 468.48 |
| CAS Registry Number | 137814-07-4 |
| SMILES | CC1=C(C2=CC=CC=C2S1)C3=C(C(C(C3(F)F)(F)F)(F)F)C4=C(SC5=CC=CC=C54)C |
| InChI | 1S/C23H14F6S2/c1-11-17(13-7-3-5-9-15(13)30-11)19-20(22(26,27)23(28,29)21(19,24)25)18-12(2)31-16-10-6-4-8-14(16)18/h3-10H,1-2H3 |
| InChIKey | CNLMHUFAXSWHFA-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 160°C (Expl.) |
| Boiling point | 506.1±50.0°C at 760 mmHg (Cal.) |
| Flash point | 259.9±30.1°C (Cal.) |
| Refractive index | 1.637 (Cal.) |
| (1) | Seiya Kobatake, Kingo Uchida, Eriko Tsuchida and Masahiro Irie. Single-crystalline photochromism of diarylethenes: reactivity–structure relationship, Chem. Commun., 2002, 0, 2804. |
|---|---|
| Market Analysis Reports |