| Pure Research Chemicals | China | |||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Classification | Analytical chemistry >> Standard >> Food and beverage standards |
|---|---|
| Name | Bisphenol A (3-chloro-2-hydroxypropyl)glycidyl ether |
| Synonyms | 1-chloro-3-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C21H25ClO4 |
| Molecular Weight | 376.87 |
| CAS Registry Number | 13836-48-1 |
| EC Number | 635-062-3 |
| SMILES | CC(C)(C1=CC=C(C=C1)OCC2CO2)C3=CC=C(C=C3)OCC(CCl)O |
| Solubility | 5.249 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.566, Calc.* |
| Melting point | 187.38 °C |
| Boiling Point | 468.09 °C, 537.3±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 278.7±30.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H317-H319 Details | ||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P272-P280-P302+P352-P305+P351+P338-P321-P332+P317-P333+P313-P337+P317-P362+P364-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |