| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink massive supplier since 2018 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Chemstock, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (715) 726-1437 | |||
![]() |
Evelyn@chemstock.com | |||
| Chemical distributor | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aliphatic carboxylate |
|---|---|
| Name | 1,2,3-Propanetriol 1,2,3-Tripropanoate |
| Synonyms | [2-Propanoyloxy-1-(Propanoyloxymethyl)Ethyl] Propanoate; Propanoic Acid [2-(1-Oxopropoxy)-1-(1-Oxopropoxymethyl)Ethyl] Ester; Propionic Acid [2-Propionyloxy-1-(Propionyloxymethyl)Ethyl] Ester |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 |
| CAS Registry Number | 139-45-7 |
| EINECS | 205-365-1 |
| FEMA | 3286 |
| SMILES | C(C(OC(CC)=O)COC(CC)=O)OC(CC)=O |
| InChI | 1S/C12H20O6/c1-4-10(13)16-7-9(18-12(15)6-3)8-17-11(14)5-2/h9H,4-8H2,1-3H3 |
| InChIKey | YZWRNSARCRTXDS-UHFFFAOYSA-N |
| Density | 1.096g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.67°C at 760 mmHg (Cal.) |
| Flash point | 120.763°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |