| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N-Hydroxymethylsaccharin |
|---|---|
| Synonyms | 1,1-Diketo-2-Methylol-1,2-Benzothiazol-3-One; Nsc75595; Nciopen2_004733 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7NO4S |
| Molecular Weight | 213.21 |
| CAS Registry Number | 13947-20-1 |
| EINECS | 237-728-5 |
| SMILES | C1=CC=CC2=C1C(N(CO)[S]2(=O)=O)=O |
| InChI | 1S/C8H7NO4S/c10-5-9-8(11)6-3-1-2-4-7(6)14(9,12)13/h1-4,10H,5H2 |
| InChIKey | PZWPTWZDBJUEMM-UHFFFAOYSA-N |
| Density | 1.625g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.293°C at 760 mmHg (Cal.) |
| Flash point | 217.662°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |