| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Manchester Organics Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Proactive Molecular Research | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 505-2681 | |||
![]() |
tony@proactivemr.com | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Organic fluorine compound >> Fluoroethane series |
|---|---|
| Name | 1,1,1,2-Tetrafluoro-2-Iodo-2-(Trifluoromethoxy)Ethane |
| Synonyms | 1,2,2,2-Tetrafluoro-1-iodoethyl trifluoromethyl ether #; 1-Iodo-1-(trifluoromethoxy)tetrafluoroethane; 1-Iodo-1,2,2,2-tetrafluoro-1-(trifluoromethoxy)ethane |
| Molecular Structure | ![]() |
| Molecular Formula | C3F7IO |
| Molecular Weight | 311.92 |
| CAS Registry Number | 139604-89-0 |
| SMILES | C(C(F)(F)F)(OC(F)(F)F)(F)I |
| InChI | 1S/C3F7IO/c4-1(5,6)2(7,11)12-3(8,9)10 |
| InChIKey | AKRCGMWXORUMMA-UHFFFAOYSA-N |
| Density | 2.2±0.1g/cm3 (Cal.) |
|---|---|
| 1.6 (Expl.) | |
| Melting point | 43-44°C (Expl.) |
| Boiling point | 43-44°C (Expl.) |
| 80.2±35.0°C at 760 mmHg (Cal.) | |
| Flash point | 2.3±25.9°C (Cal.) |
| Refractive index | 1.366 (Cal.) |
| Safety Description | IRRITANT |
|---|---|
| Irritant | |
| CAUTION: May irritate eyes, skin, and respiratory tract | |
| WARNING:Harmful by skin absorption/ingestion, irritates skin | |
| SDS | Available |
| Market Analysis Reports |