| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Specs Ltd. | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | Metiazinic Acid |
|---|---|
| Synonyms | 2-(10-Methyl-2-Phenothiazinyl)Acetic Acid; 2-(10-Methylphenothiazin-2-Yl)Ethanoic Acid; (10-Methyl-10H-Phenothiazin-2-Yl)Acetic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.33 |
| CAS Registry Number | 13993-65-2 |
| EINECS | 237-795-0 |
| SMILES | C1=C(CC(O)=O)C=CC2=C1N(C3=C(S2)C=CC=C3)C |
| InChI | 1S/C15H13NO2S/c1-16-11-4-2-3-5-13(11)19-14-7-6-10(8-12(14)16)9-15(17)18/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | LMINNBXUMGNKMM-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.6±44.0°C at 760 mmHg (Cal.) |
| Flash point | 245.7±28.4°C (Cal.) |
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |