|
CAS#: 14016-29-6 Product: Averufin No suppilers available for the product. |
| Name | Averufin |
|---|---|
| Synonyms | 2,6-Epoxy-2H-Anthra(2,3-B)Oxocin-8,13-Dione, 3,4,5,6-Tetrahydro-2-Methyl-7,9,11-Trihydroxy-; 2,6-Epoxy-2H-Anthra(2,3-B)Oxocin-8,13-Dione, 3,4,5,6-Tetrahydro-7,9,11-Trihydroxy-2-Methyl-, (2S)-; 2-Methyl-7,9,11-Trihydroxy-3,4,5,6-Tetrahydro-2,6-Epoxy-2H-Anthra(2,3-B)Oxocin-8,13-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 |
| CAS Registry Number | 14016-29-6 (28458-23-3) |
| SMILES | C2=C1OC5(OC(C1=C(O)C3=C2C(=O)C4=C(C3=O)C(=CC(=C4)O)O)CCC5)C |
| InChI | 1S/C20H16O7/c1-20-4-2-3-12(26-20)16-13(27-20)7-10-15(19(16)25)18(24)14-9(17(10)23)5-8(21)6-11(14)22/h5-7,12,21-22,25H,2-4H2,1H3 |
| InChIKey | RYFFZJHGQCKWMV-UHFFFAOYSA-N |
| Density | 1.586g/cm3 (Cal.) |
|---|---|
| Boiling point | 602.925°C at 760 mmHg (Cal.) |
| Flash point | 220.791°C (Cal.) |
| (1) | Assante Gemma, Locci Romano, Camarda Lorenzo, Merlini Lucio, Nasini Gianluca. Screening of the genus Cercospora for secondary metabolites☆, Phytochemistry, 1977 |
|---|---|
| Market Analysis Reports |