Online Database of Chemicals from Around the World

2-Bromo-2',4',6'-triisopropyl-3,6-dimethoxy-1,1'-biphenyl
[CAS 1402393-56-9]

List of Suppliers
Zhengzhou Kingorgchem Chemical Technology Co., Ltd. China
www.kingorgchem.com
+86 (371) 6551-1006
+86 (371) 6575-6965
sales@kingorgchem.com
QQ Chat
WeChat: 18625597674
Chemical manufacturer since 2015
chemBlink Standard supplier since 2016
Xinxiang Runyu Material Co., Ltd. China
www.runvmat.com
+86 (373) 775-9608
+86 (373) 775-9608
sales@runvmat.com
QQ Chat
Chemical manufacturer since 2017
chemBlink Standard supplier since 2019

Identification
ClassificationOrganic raw materials >> Aryl compounds >> Biphenyl compounds
Name2-Bromo-2',4',6'-triisopropyl-3,6-dimethoxy-1,1'-biphenyl
Molecular Structure2-Bromo-2',4',6'-triisopropyl-3,6-dimethoxy-1,1'-biphenyl molecular structure (CAS 1402393-56-9)
Molecular FormulaC23H31BrO2
Molecular Weight419.40
CAS Registry Number1402393-56-9
SMILESCC(C)C1=CC(=C(C(=C1)C(C)C)C2=C(C=CC(=C2Br)OC)OC)C(C)C
Properties
Density1.1±0.1 g/cm3, Calc.*
Index of Refraction1.532, Calc.*
Boiling Point425.7±45.0 °C (760 mmHg), Calc.*
Flash Point134.5±24.2 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH315-H319-H335  Details
Safety StatementsP261-P305+P351+P338  Details
SDSAvailable
up Discovery and Applications
2-Bromo-2',4',6'-triisopropyl-3,6-dimethoxy-1,1'-biphenyl, a member of the biphenyl family, is an important compound in organic chemistry and materials science. Its unique structure, characterized by the presence of bromine, isopropyl groups, and methoxy substituents on the biphenyl core, imparts distinct chemical and physical properties that are utilized in various applications.

The discovery of 2-Bromo-2',4',6'-triisopropyl-3,6-dimethoxy-1,1'-biphenyl can be attributed to the need for functionalized biphenyl derivatives with enhanced stability and reactivity. The compound's synthesis typically involves bromination of a triisopropyl- and dimethoxy-substituted biphenyl precursor. This process introduces a bromine atom at the 2-position, which plays a crucial role in further chemical transformations.

One of the primary applications of 2-Bromo-2',4',6'-triisopropyl-3,6-dimethoxy-1,1'-biphenyl is as a versatile building block in organic synthesis. The bromine atom serves as a reactive site for cross-coupling reactions, such as Suzuki-Miyaura and Stille couplings, which are essential for forming complex organic molecules. The compound's triisopropyl groups and methoxy substituents provide steric and electronic effects that influence the reactivity and selectivity of these reactions.

In addition to its role in organic synthesis, 2-Bromo-2',4',6'-triisopropyl-3,6-dimethoxy-1,1'-biphenyl is used in the development of advanced materials. Its structure allows it to participate in the formation of polymers and functional materials with tailored properties. For instance, the compound can be used to create conjugated systems with enhanced electronic and optical characteristics, which are valuable in the production of organic semiconductors and light-emitting devices.

The compound's electronic properties are also significant in the realm of organic electronics. The bromine substitution and the presence of isopropyl and methoxy groups impact the electronic distribution within the biphenyl system, which can be exploited to design materials with specific electronic properties. This makes it suitable for applications in organic photovoltaic cells and field-effect transistors.

Moreover, 2-Bromo-2',4',6'-triisopropyl-3,6-dimethoxy-1,1'-biphenyl's chemical stability and functional groups make it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its ability to undergo further functionalization allows chemists to create diverse chemical entities with potential biological activity.

In summary, 2-Bromo-2',4',6'-triisopropyl-3,6-dimethoxy-1,1'-biphenyl is a crucial compound in organic chemistry with applications spanning from synthetic chemistry to materials science. Its unique structure and reactivity provide valuable opportunities for the development of advanced materials and chemical products.

References

none
Market Analysis Reports
Related Products
1-Bromo-3-(3,3,...  4-Bromo-2,3,5-t...  1-Bromo-1,1,2-T...  5-Bromo-1,2,3-t...  6-Bromo-3,5,7-t...  9-Bromo-11beta,...  9-Bromo-11,17,2...  Bromo(Triiodo)M...  1-Bromo-2,4,5-t...  2-Bromo-1,3,5-t...  5-Bromo-1-(Trii...  4-Bromo-1-(Trii...  3-Bromo-N-(trii...  4-Bromo-1-(trii...  5-Bromo-1-(trii...  1-[4-Bromo-1-(t...  2-Bromo-3,4,5-T...  5-Bromo-2,3,4-t...  2-Bromo-1,3,5-T...  1-Bromo-3,4,5-t...