| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 5-Anilino-4-Phenyl-4H-1,2,4-Triazole-3-Thiol |
|---|---|
| Synonyms | 3H-1,2,4-Triazole-3-Thione, 2,4-Dihydro-4-Phenyl-5-Phenylamino-; 3H-1,2,4-Triazol-3-Thione, 2,4-Dihydro-4-Phenyl-5-(Phenylamino) |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.34 |
| CAS Registry Number | 14132-84-4 |
| EINECS | 237-984-8 |
| SMILES | C3=C(N1C(=NNC1=S)NC2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C14H12N4S/c19-14-17-16-13(15-11-7-3-1-4-8-11)18(14)12-9-5-2-6-10-12/h1-10H,(H,15,16)(H,17,19) |
| InChIKey | ADVANMXLTWBUFC-UHFFFAOYSA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.199°C at 760 mmHg (Cal.) |
| Flash point | 186.762°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Ali Hussain Reshak, Dalibor Stys, S. Auluck and I. V. Kityk. Density functional calculations of the electronic structure of 3-phenylamino-4-phenyl-1,2,4-triazole-5-thione, Phys. Chem. Chem. Phys., 2010, 12, 2975. |
|---|---|
| Market Analysis Reports |