| Zhengzhou Kingorgchem Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.kingorgchem.com | |||
![]() | +86 (371) 6551-1006 | |||
![]() | +86 (371) 6575-6965 | |||
![]() | sales@kingorgchem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18625597674 | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Territorial Sea Technology Qingdao Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.leadhigh.com.cn | |||
![]() | +86 15092083467 | |||
![]() | 13675327813@163.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyridine compound |
|---|---|
| Name | Copper(1+) trifluoromethanethiolate - 2,2'-bipyridine (1:1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8CuF3N2S |
| Molecular Weight | 320.80 |
| CAS Registry Number | 1413732-47-4 |
| EC Number | 858-445-9 |
| SMILES | c1ccnc(c1)c2ccccn2.C(F)(F)(F)[S-].[Cu+] |
| Hazard Symbols | |||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319 Details | ||||||||||||||||||||||||||||||||
| Safety Statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 Details | ||||||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||||||
|
Copper(I) trifluoromethanethiolate-2,2'-bipyridine (1:1:1) is a significant organometallic compound that has garnered attention for its unique properties and applications in coordination chemistry and catalysis. This compound is composed of a copper(I) center coordinated with trifluoromethanethiolate ligands and 2,2'-bipyridine, forming a stable complex with a 1:1:1 stoichiometric ratio of its components. The discovery of Copper(I) trifluoromethanethiolate-2,2'-bipyridine can be attributed to efforts aimed at exploring new copper(I) complexes with potential applications in various chemical processes. Copper(I) complexes are known for their versatility and reactivity, making them valuable in both research and industrial contexts. The trifluoromethanethiolate ligand introduces unique electronic and steric properties, which influence the behavior of the copper center. Meanwhile, 2,2'-bipyridine acts as a bidentate ligand that stabilizes the copper(I) center through coordination. One of the primary applications of Copper(I) trifluoromethanethiolate-2,2'-bipyridine is in the field of catalysis. This compound has been utilized as a catalyst in several important organic transformations, including cross-coupling reactions and carbon-carbon bond formation. The stability of the copper(I) center, combined with the electronic effects of the trifluoromethanethiolate ligands, makes this complex an effective catalyst for various reactions. Additionally, the 2,2'-bipyridine ligand enhances the complex's solubility and reactivity, further expanding its utility in catalytic processes. In addition to its catalytic applications, Copper(I) trifluoromethanethiolate-2,2'-bipyridine is employed in the study of electronic and photophysical properties. The compound's unique ligand environment influences its electronic structure, making it an interesting system for investigating light absorption and emission characteristics. Such studies are valuable for developing new materials for optoelectronic applications, including sensors and light-emitting devices. The compound also finds use in the development of new materials and coordination polymers. The strong coordination interactions between the copper center and the ligands allow for the construction of materials with tailored properties. These materials can exhibit specific magnetic, electronic, and optical characteristics, which are important for applications in areas such as materials science and nanotechnology. In summary, Copper(I) trifluoromethanethiolate-2,2'-bipyridine is a notable compound in organometallic chemistry due to its unique combination of ligands and its diverse applications. Its role as a catalyst, its influence on electronic and photophysical properties, and its utility in materials development highlight its importance in both research and practical applications. References none |
| Market Analysis Reports |