| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Name | Diphenylhydroxyphosphoranethione |
|---|---|
| Synonyms | Hydroxy-Di(Phenyl)-Thioxo-Phosphorane; Hydroxy-Di(Phenyl)-Thioxophosphorane; Hydroxy-Di(Phenyl)-Sulfanylidene-Phosphorane |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11OPS |
| Molecular Weight | 234.25 |
| CAS Registry Number | 14278-72-9 |
| SMILES | C1=CC=CC=C1[P](O)(=S)C2=CC=CC=C2 |
| InChI | 1S/C12H11OPS/c13-14(15,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H,13,15) |
| InChIKey | UHFIMVQOGRRZRM-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.116°C at 760 mmHg (Cal.) |
| Flash point | 186.712°C (Cal.) |
| (1) | Hajar el Hajjouji, Eva Belmonte, Jesús García-López, Ignacio Fernández, María José Iglesias, Laura Roces, Santiago García-Granda, Anas El Laghdach and Fernando López Ortiz. Transformations of diphenylphosphinothioic acid tertiary amides mediated by directed ortho metallation, Org. Biomol. Chem., 2012, 10, 5647. |
|---|---|
| Market Analysis Reports |