| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | N,N-Diethyl-2-(Phenylamino)Acetamide |
|---|---|
| Synonyms | N,N-Diethyl-2-(Phenylamino)Ethanamide; 2-Anilino-N,N-Diethylacetamide; Acetamide, 2-Anilino-N,N-Diethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 |
| CAS Registry Number | 14307-90-5 |
| SMILES | C1=CC=CC=C1NCC(N(CC)CC)=O |
| InChI | 1S/C12H18N2O/c1-3-14(4-2)12(15)10-13-11-8-6-5-7-9-11/h5-9,13H,3-4,10H2,1-2H3 |
| InChIKey | DQKMLOJHVJGWCB-UHFFFAOYSA-N |
| Density | 1.054g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.283°C at 760 mmHg (Cal.) |
| Flash point | 172.903°C (Cal.) |
| (1) | James C. Anderson and Sarah Skerratt. Synthesis of a,a-disubstituted unnatural amino acid derivatives using the aza-[2,3]-Wittig sigmatropic rearrangement, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 2871. |
|---|---|
| Market Analysis Reports |