| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Aronis | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (926) 578-0336 | |||
![]() |
rakishev@aronis.ru | |||
| Chemical manufacturer | ||||
| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Rare Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | N,N-Dimethylbenzenesulphonamide |
|---|---|
| Synonyms | Nciopen2_001103; Benzenesulfonic Dimethylamide; Nsc86567 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.24 |
| CAS Registry Number | 14417-01-7 |
| SMILES | C1=CC=CC=C1[S](=O)(=O)N(C)C |
| InChI | 1S/C8H11NO2S/c1-9(2)12(10,11)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | BVSPJPNNLDIUFE-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.879°C at 760 mmHg (Cal.) |
| Flash point | 125.486°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Christopher J. Chapman, Christopher G. Frost and Mary F. Mahon. Structure and reactivity of new phosphine ligands containing the hemi-labile sulfone moiety, Dalton Trans., 2006, 0, 2251. |
|---|---|
| Market Analysis Reports |