| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Crescent Chemical Co. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Classification | Flavors and spices >> Synthetic spice >> Musk and macrocyclic spices >> Nitro musk |
|---|---|
| Name | 1-(1,1-Dimethylethyl)-3,4,5-Trimethyl-2,6-Dinitro-Benzene |
| Synonyms | 1-Tert-Butyl-3,4,5-Trimethyl-2,6-Dinitro-Benzene; 5-Tert-Butyl-4,6-Dinitro-1,2,3-Trimethylbenzene; 5-Tert-Butyl-1,2,3-Trimethyl-4,6-Dinitrobenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 |
| CAS Registry Number | 145-39-1 |
| EINECS | 205-651-6 |
| SMILES | CC(C1=C([N+]([O-])=O)C(=C(C(=C1[N+]([O-])=O)C)C)C)(C)C |
| InChI | 1S/C13H18N2O4/c1-7-8(2)11(14(16)17)10(13(4,5)6)12(9(7)3)15(18)19/h1-6H3 |
| InChIKey | MINYPECWDZURGR-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.01°C at 760 mmHg (Cal.) |
| Flash point | 174.583°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |