| Name | 1,4-Diiodo-2,5-Bis(Octyloxy)Benzene |
|---|---|
| Synonyms | 1,4-dioctyloxy-2,5-diiodobenzene; 2,5-dioctyloxy-1,4-diiodobenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C22H36I2O2 |
| Molecular Weight | 586.33 |
| CAS Registry Number | 145483-68-7 |
| SMILES | CCCCCCCCOC1=CC(=C(C=C1I)OCCCCCCCC)I |
| InChI | 1S/C22H36I2O2/c1-3-5-7-9-11-13-15-25-21-17-20(24)22(18-19(21)23)26-16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3 |
| InChIKey | CRJMVBFLAJFWTD-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 544.4±50.0°C at 760 mmHg (Cal.) |
| Flash point | 283.0±30.1°C (Cal.) |
| Refractive index | 1.544 (Cal.) |
| (1) | Muhammad S. Khan, Muna R. A. Al-Mandhary, Mohammed K. Al-Suti, Birte Ahrens, Mary F. Mahon, Louise Male, Paul R. Raithby, Clare E. Boothby and Anna Köhler. Synthesis, characterisation and optical spectroscopy of diynes and poly-ynes containing derivatised fluorenes in the backbone, Dalton Trans., 2003, 0, 74. |
|---|---|
| Market Analysis Reports |