| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | N,N-Diallyl-2,2,2-Trifluoroacetamide |
|---|---|
| Synonyms | N,N-Diallyl-2,2,2-Trifluoro-Acetamide; N,N-Diallyl-2,2,2-Trifluoroacetamide; 2,2,2-Trifluoro-N,N-Di(Prop-2-Enyl)Ethanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10F3NO |
| Molecular Weight | 193.17 |
| CAS Registry Number | 14618-49-6 |
| SMILES | C(N(C(C(F)(F)F)=O)CC=C)C=C |
| InChI | 1S/C8H10F3NO/c1-3-5-12(6-4-2)7(13)8(9,10)11/h3-4H,1-2,5-6H2 |
| InChIKey | YLFAOCVUPKJNHP-UHFFFAOYSA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 221.492°C at 760 mmHg (Cal.) |
| Flash point | 87.755°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Carolin Lang, Ute Gärtner and Oliver Trapp. Catalysts by the meter: rapid screening approach of N-heterocyclic carbene ligand based catalysts, Chem. Commun., 2011, 47, 391. |
|---|---|
| Market Analysis Reports |