| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Name | 2-[[2-[(2-Aminoacetyl)Amino]-3-Phenyl-Propanoyl]Amino]Acetic Acid |
|---|---|
| Synonyms | 2-[[2-[(2-Aminoacetyl)Amino]-3-Phenyl-Propanoyl]Amino]Acetic Acid; 2-[[2-[(2-Amino-1-Oxoethyl)Amino]-1-Oxo-3-Phenylpropyl]Amino]Acetic Acid; 2-[[2-(Glycylamino)-3-Phenyl-Propanoyl]Amino]Acetic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 |
| CAS Registry Number | 14656-09-8 |
| SMILES | C1=C(CC(C(NCC(O)=O)=O)NC(CN)=O)C=CC=C1 |
| InChI | 1S/C13H17N3O4/c14-7-11(17)16-10(13(20)15-8-12(18)19)6-9-4-2-1-3-5-9/h1-5,10H,6-8,14H2,(H,15,20)(H,16,17)(H,18,19) |
| InChIKey | IGOYNRWLWHWAQO-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 678.491°C at 760 mmHg (Cal.) |
| Flash point | 364.138°C (Cal.) |
| (1) | Annia Galano and Armando Cruz-Torres. OH radical reactions with phenylalanine in free and peptide forms, Org. Biomol. Chem., 2008, 6, 732. |
|---|---|
| Market Analysis Reports |