|
CAS#: 14860-64-1 Product: 4-Azidoaniline No suppilers available for the product. |
| Name | 4-Azidoaniline |
|---|---|
| Synonyms | (4-Azidophenyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6N4 |
| Molecular Weight | 134.14 |
| CAS Registry Number | 14860-64-1 |
| EINECS | 238-929-0 |
| SMILES | [N+](=NC1=CC=C(N)C=C1)=[N-] |
| InChI | 1S/C6H6N4/c7-5-1-3-6(4-2-5)9-10-8/h1-4H,7H2 |
| InChIKey | SSMVDPYHLFEAJE-UHFFFAOYSA-N |
| (1) | Elena A. Pritchina, Nina P. Gritsan and Thomas Bally. Matrix isolation and computational study of the photochemistry of p-azidoaniline, Phys. Chem. Chem. Phys., 2006, 8, 719. |
|---|---|
| Market Analysis Reports |