| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (2S,3S)-3-[[3,5-Bis(Trifluoromethyl)Phenyl]Methoxy]-2-Phenylpiperidine |
|---|---|
| Synonyms | (2S,3S)-3-[[3,5-Bis(Trifluoromethyl)Phenyl]Methoxy]-2-Phenyl-Piperidine; (2S,3S)-3-[3,5-Bis(Trifluoromethyl)Benzyl]Oxy-2-Phenyl-Piperidine; Lopac0_000752 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H19F6NO |
| Molecular Weight | 403.37 |
| CAS Registry Number | 148700-85-0 |
| SMILES | [C@@H]2(OCC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)[C@@H](NCCC2)C3=CC=CC=C3 |
| InChI | 1S/C20H19F6NO/c21-19(22,23)15-9-13(10-16(11-15)20(24,25)26)12-28-17-7-4-8-27-18(17)14-5-2-1-3-6-14/h1-3,5-6,9-11,17-18,27H,4,7-8,12H2/t17-,18-/m0/s1 |
| InChIKey | FCDRFVCGMLUYPG-ROUUACIJSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.473°C at 760 mmHg (Cal.) |
| Flash point | 185.718°C (Cal.) |
| (1) | Sunil V. Pansare and Eldho K. Paul. Synthesis of (+)-L-733,060, (+)-CP-99,994 and (2S,3R)-3-hydroxypipecolic acid: Application of an organocatalytic direct vinylogous aldol reaction, Org. Biomol. Chem., 2012, 10, 2119. |
|---|---|
| Market Analysis Reports |