| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Epsilon Chimie Chemical Manufacturer | France | |||
|---|---|---|---|---|
![]() |
+33 (2) 9842-4650 | |||
![]() |
pierre.cornec@epsilon-chimie.com | |||
| Chemical manufacturer | ||||
| Name | 3-Carboxyphenylphosphonic Acid |
|---|---|
| Synonyms | Aids144269; Nsc666474; Nsc408732 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7O5P |
| Molecular Weight | 202.10 |
| CAS Registry Number | 14899-31-1 |
| SMILES | C1=C(C=CC=C1[P](O)(O)=O)C(O)=O |
| InChI | 1S/C7H7O5P/c8-7(9)5-2-1-3-6(4-5)13(10,11)12/h1-4H,(H,8,9)(H2,10,11,12) |
| InChIKey | ZKKXCRILZNBJJM-UHFFFAOYSA-N |
| Density | 1.657g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.136°C at 760 mmHg (Cal.) |
| Flash point | 267.16°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Richard Singleton, James Bye, James Dyson, Gary Baker, Robert M. Ranson and Gary B. Hix. Tailoring the photoluminescence properties of transition metal phosphonates, Dalton Trans., 2010, 39, 6024. |
|---|---|
| Market Analysis Reports |