| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 5,8-Dihydroxy-2-Methoxy-1,4-Naphthoquinone |
|---|---|
| Synonyms | 1,4-Naphthoquinone, 5,8-dihydroxy-2-methoxy-; 5,8-Dihydroxy-2-methoxynaphthoquinone # |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8O5 |
| Molecular Weight | 220.18 |
| CAS Registry Number | 14918-66-2 |
| SMILES | COC1=CC(=O)C2=C(C=CC(=C2C1=O)O)O |
| InChI | 1S/C11H8O5/c1-16-8-4-7(14)9-5(12)2-3-6(13)10(9)11(8)15/h2-4,12-13H,1H3 |
| InChIKey | PMJJQZXJIRDYGM-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.9±50.0°C at 760 mmHg (Cal.) |
| Flash point | 213.4±23.6°C (Cal.) |
| Refractive index | 1.669 (Cal.) |
| (1) | Arnone Alberto, Merlini Lucio, Nasini Gianluca, de Pava Orso Vajna. Direct Amination of Naphthazarin, Juglone, and Some Derivatives, Synthetic Communications, 2007 |
|---|---|
| Market Analysis Reports |