| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 2-[Bis(2-Pyridinylmethyl)Amino]Ethanol |
|---|---|
| Synonyms | 2-(Bis-(2-Pyridyl-Methyl)-Amino)-Ethanol; 2-(BIS-(2-PYRIDYLMETHYL)-AMINO)-ETHANOL; N,N-bis(2-pyridylmethyl)-2-aminoethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.30 |
| CAS Registry Number | 149860-22-0 |
| SMILES | C1=CC=NC(=C1)CN(CCO)CC2=CC=CC=N2 |
| InChI | 1S/C14H17N3O/c18-10-9-17(11-13-5-1-3-7-15-13)12-14-6-2-4-8-16-14/h1-8,18H,9-12H2 |
| InChIKey | DUFCPZLMEULRED-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.0±32.0°C at 760 mmHg (Cal.) |
| Flash point | 184.8±25.1°C (Cal.) |
| Refractive index | 1.601 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Jong Won Shin, Sankara Rao Rowthu, Bong Gon Kim and Kil Sik Min. A zigzag tetranuclear iron(iii)(bpaeO)(CHO)(N)] coexisting both ferromagnetic and antiferromagnetic couplings (bpaeOH = N,N-bis(2-pyridylmethyl)-2-aminoethanol), Dalton Trans., 2010, 39, 2765. |
|---|---|
| Market Analysis Reports |