| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1-(4-Ethyl-3,5-Dimethyl-1H-Pyrrol-2-Yl)-Ethanone |
|---|---|
| Synonyms | 2-Acetyl-3,5-Dimethyl-4-Ethyl-Pyrrole; 4-Ethyl-3,5-Dimethylpyrrol-2-Yl Methyl Ketone; 5-21-07-00264 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.23 |
| CAS Registry Number | 1500-91-0 |
| SMILES | C(C)C1=C([NH]C(=C1C)C(=O)C)C |
| InChI | 1S/C10H15NO/c1-5-9-6(2)10(8(4)12)11-7(9)3/h11H,5H2,1-4H3 |
| InChIKey | SUAXMKRXTCGJJD-UHFFFAOYSA-N |
| Density | 1.003g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.342°C at 760 mmHg (Cal.) |
| Flash point | 135.838°C (Cal.) |
| (1) | M. O. Senge and K. M. Smith. Hydrogen-bonding patterns in six derivatives of 2,4-dimethylpyrrole, Acta Cryst. (2005). C61, o537-o541 |
|---|---|
| Market Analysis Reports |