| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| PHARMEKS Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 702-9648 | |||
![]() |
sales@pharmeks.com | |||
| Chemical manufacturer since 2000 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+38 (044) 531-9497 | |||
![]() |
sales@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | (1-Aminoethylidene)Bisphosphonic Acid |
|---|---|
| Synonyms | (1-Amino-1-Phosphono-Ethyl)Phosphonic Acid; (1-Aminoethylidene)Bisphosphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C2H9NO6P2 |
| Molecular Weight | 205.04 |
| CAS Registry Number | 15049-85-1 |
| EINECS | 239-120-5 |
| SMILES | CC([P](O)(O)=O)([P](O)(O)=O)N |
| InChI | 1S/C2H9NO6P2/c1-2(3,10(4,5)6)11(7,8)9/h3H2,1H3,(H2,4,5,6)(H2,7,8,9) |
| InChIKey | GPCTYPSWRBUGFH-UHFFFAOYSA-N |
| Density | 1.979g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.3°C at 760 mmHg (Cal.) |
| Flash point | 280.564°C (Cal.) |
| (1) | Shuo-ping Chen, Yu-qin Zhang, Le Hu, Hong-zhen He and Liang-jie Yuan. Hydrogen-bonded assembly of aminophosphonic anions: different 1D, 2D and 3D supramolecular architectures, CrystEngComm, 2010, 12, 3327. |
|---|---|
| Market Analysis Reports |