| Chizhou Dongsheng Pharmaceutical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.dspharmchem.com | |||
![]() | +86 (576) 8429-2571 | |||
![]() | +86 (576) 8429-2560 | |||
![]() | ksz@dspharmchem.com | |||
| Chemical manufacturer since 1995 | ||||
| chemBlink Premium supplier since 2011 | ||||
| Classification | Organic raw materials >> Ketone compound |
|---|---|
| Name | 5-(2-Methoxyphenoxy)-[2,2'-bipyrimidine]-4,6(1H,5H)-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12N4O4 |
| Molecular Weight | 312.28 |
| CAS Registry Number | 150728-12-4 |
| EC Number | 604-748-4 |
| SMILES | COC1=CC=CC=C1OC2C(=O)NC(=NC2=O)C3=NC=CC=N3 |
| Density | 1.45 |
|---|---|
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P305+P351+P338 Details |
| SDS | Available |
|
5-(2-Methoxyphenoxy)-[2,2'-bipyrimidine]-4,6(1H,5H)-dione is a heterocyclic compound with promising potential in pharmaceutical and chemical research. Its structure combines a bipyrimidine core with a methoxyphenoxy moiety, which contributes to its versatility and activity in various chemical reactions and biological systems. The bipyrimidine scaffold is well-known for its ability to form strong interactions with biological targets, making compounds like this one of great interest for drug discovery, particularly in the field of kinase inhibition and DNA-interacting agents. The discovery of 5-(2-Methoxyphenoxy)-[2,2'-bipyrimidine]-4,6(1H,5H)-dione resulted from ongoing research into bipyrimidine derivatives. These compounds have been recognized for their ability to inhibit enzymes and act as ligands for transition metal catalysts. The inclusion of a 2-methoxyphenoxy group further enhances the compound’s potential by improving solubility and modulating its electronic properties. This modification also influences the molecule’s overall reactivity and binding affinity with biological macromolecules. One of the primary applications of 5-(2-Methoxyphenoxy)-[2,2'-bipyrimidine]-4,6(1H,5H)-dione is in drug discovery, especially for developing kinase inhibitors. Kinases are enzymes that regulate various cellular processes, including growth, metabolism, and apoptosis. Dysregulation of kinase activity is often linked to cancer and other diseases. By interacting with kinase active sites, compounds such as this one can block aberrant signaling pathways, inhibiting tumor growth and proliferation. The bipyrimidine core enables strong interactions with the ATP-binding sites of kinases, while the methoxyphenoxy group enhances specificity. In addition to its role in kinase inhibition, the compound has potential applications in materials science. The bipyrimidine framework is known for its ability to coordinate with transition metals, forming complexes that can serve as catalysts in various organic transformations. These complexes are valuable in fields such as polymer science and green chemistry, where catalytic efficiency and selectivity are crucial. Furthermore, 5-(2-Methoxyphenoxy)-[2,2'-bipyrimidine]-4,6(1H,5H)-dione can be explored for its DNA-binding properties. Bipyrimidine derivatives have shown the ability to intercalate with DNA, which may lead to the development of novel anticancer agents or antibiotics that target DNA replication and transcription processes. The presence of the methoxyphenoxy group could enhance this compound’s selectivity and reduce off-target effects, making it a more refined candidate for therapeutic applications. As research into this compound continues, its chemical versatility suggests that it may find broader applications in fields ranging from catalysis to molecular biology. However, challenges such as optimizing its bioavailability, reducing toxicity, and improving its pharmacokinetic properties must be addressed before it can be fully integrated into therapeutic protocols. Future studies will likely focus on refining its structure to enhance its efficacy while minimizing potential side effects. References 2003. Bosentan. Pharmaceutical Substances. URL: https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-02-0107 |
| Market Analysis Reports |