| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | 2-Methyl-2-Propanyl N-(Diphenylmethyl)Glycinate |
|---|---|
| Synonyms | Benzhydrylaminoacetic Acid tert-Butyl Ester; N-diphenylmethyl glycine tert-butyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.39 |
| CAS Registry Number | 158980-46-2 |
| SMILES | CC(C)(C)OC(=O)CNC(C1=CC=CC=C1)C2=CC=CC=C2 |
| InChI | 1S/C19H23NO2/c1-19(2,3)22-17(21)14-20-18(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,18,20H,14H2,1-3H3 |
| InChIKey | ZWWNPSADOUWQRL-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.7±30.0°C at 760 mmHg (Cal.) |
| Flash point | 191.9±24.6°C (Cal.) |
| Refractive index | 1.544 (Cal.) |
| (1) | Md. Masud Parvez, Naoki Haraguchi and Shinichi Itsuno. Molecular design of chiral quaternary ammonium polymers for asymmetric catalysis applications, Org. Biomol. Chem., 2012, 10, 2870. |
|---|---|
| Market Analysis Reports |