| Asinex Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 780-3415 / 780-3417 | |||
![]() |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Interbioscreen Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 1',3',3'-Trimethyl-1',3'-Dihydrospiro[Benzo[f]Chromene-3,2'-Indole] |
|---|---|
| Synonyms | 1,3,3-Trimethylindoline-2-spiro-2'-(5',6'-benzo)-α-chromen; 1,3,3-TRIMETHYLINDOLINO-β-NAPHTHOPYRYLOSPIRAN; 1,3,3-Tri |
| Molecular Structure | ![]() |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.42 |
| CAS Registry Number | 1592-43-4 |
| SMILES | O1c5c(\C=C/C13N(c2c(cccc2)C3(C)C)C)c4ccccc4cc5 |
| InChI | 1S/C23H21NO/c1-22(2)19-10-6-7-11-20(19)24(3)23(22)15-14-18-17-9-5-4-8-16(17)12-13-21(18)25-23/h4-15H,1-3H3 |
| InChIKey | DTQKEQFXLWFVCS-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Melting point | 174°C (Expl.) |
| Boiling point | 492.731°C at 760 mmHg (Cal.) |
| Flash point | 142.772°C (Cal.) |
| Refractive index | 1.7 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Jun Harada, Yuta Kawazoe and Keiichiro Ogawa. Photochromism of spiropyrans and spirooxazines in the solid state: low temperature enhances photocoloration, Chem. Commun., 2010, 46, 2593. |
|---|---|
| Market Analysis Reports |