| AfferChem, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 993-6088 | |||
![]() |
sales@afferchem.com | |||
| Chemical manufacturer | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Name | 2-Amino-4,4,4-Trifluorobutyric Acid |
|---|---|
| Synonyms | (2S)-2-Azaniumyl-4,4,4-Trifluoro-Butanoate; (2S)-2-Ammonio-4,4,4-Trifluorobutanoate; (2S)-2-Ammonio-4,4,4-Trifluoro-Butyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H6F3NO2 |
| Molecular Weight | 157.09 |
| CAS Registry Number | 15960-05-1 |
| SMILES | [C@H]([NH3+])(CC(F)(F)F)C([O-])=O |
| InChI | 1S/C4H6F3NO2/c5-4(6,7)1-2(8)3(9)10/h2H,1,8H2,(H,9,10)/t2-/m0/s1 |
| InChIKey | AQPCXCOPDSEKQT-REOHCLBHSA-N |
| Density | 1.432g/cm3 (Cal.) |
|---|---|
| Boiling point | 185.193°C at 760 mmHg (Cal.) |
| Flash point | 65.803°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Toni Vagt, Elisabeth Nyakatura, Mario Salwiczek, Christian Jäckel and Beate Koksch. Towards identifying preferred interaction partners of fluorinated amino acids within the hydrophobic environment of a dimeric coiled coil peptide, Org. Biomol. Chem., 2010, 8, 1382. |
|---|---|
| Market Analysis Reports |