| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 7-{[(2E)-3-Iodo-2-Propen-1-Yl](Propyl)Amino}-5,6,7,8-Tetrahydro-1-Naphthalenol Ethanedioate (1:1) |
|---|---|
| Synonyms | (RS)-tran |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24INO5 |
| Molecular Weight | 461.29 |
| CAS Registry Number | 159651-91-9 |
| SMILES | CCCN(C/C=C/I)C1CCC2=C(C1)C(=CC=C2)O.C(=O)(C(=O)O)O |
| InChI | 1S/C16H22INO.C2H2O4/c1-2-10-18(11-4-9-17)14-8-7-13-5-3-6-16(19)15(13)12-14;3-1(4)2(5)6/h3-6,9,14,19H,2,7-8,10-12H2,1H3;(H,3,4)(H,5,6)/b9-4+; |
| InChIKey | XIBSIFOFYWBOAQ-JOKMOOFLSA-N |
| Refractive index | (Cal.) |
|---|---|
| solubility | Soluble to 100 mM in ethanol and to 100 mM in DMSO |
| Market Analysis Reports |