| Shanghai Zhuyao Pharmaceutical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | cn.pharmalego.com | |||
![]() | +86 (021) 5859-6383 | |||
![]() | marketing@pharmalego.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2023 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives |
|---|---|
| Name | [2-(Fmoc-amino)acetamido]methyl Acetate |
| Synonyms | [[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methyl acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.38 |
| CAS Registry Number | 1599440-06-8 |
| SMILES | CC(=O)OCNC(=O)CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.584, Calc.* |
| Boiling Point | 626.6±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 332.8±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319 Details |
| Safety Statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 Details |
| SDS | Available |
|
[2-(Fmoc-amino)acetamido]methyl Acetate is a chemical compound primarily used as a reagent in the synthesis of peptides and proteins. It belongs to a class of compounds called Fmoc (Fluorenylmethyloxycarbonyl)-protected amino acids, which are widely utilized in solid-phase peptide synthesis (SPPS). This compound has garnered significant attention due to its ability to facilitate the formation of peptide bonds while offering high selectivity and stability under synthetic conditions. The discovery of Fmoc-protected amino acids, including [2-(Fmoc-amino)acetamido]methyl Acetate, dates back to the 1970s when researchers were exploring new methods to improve the efficiency of peptide synthesis. The Fmoc protection group, which can be easily removed using a base such as piperidine, revolutionized peptide chemistry by providing a more reliable and less labor-intensive alternative to the traditional Boc (t-butoxycarbonyl) strategy. This advancement enabled the synthesis of longer peptides with higher yields, making Fmoc chemistry an essential tool in both academic and industrial research. [2-(Fmoc-amino)acetamido]methyl Acetate is used in the preparation of peptides with specific amino acid sequences. The Fmoc group protects the amino group of the amino acid during the synthesis process, preventing unwanted side reactions and ensuring that the peptide bond is formed at the correct site. This protection is crucial for maintaining the integrity of the peptide chain as it grows, allowing for precise control over the sequence and structure of the final product. The compound plays an important role in the design and synthesis of peptides for pharmaceutical and biomedical applications. Peptides have emerged as promising therapeutic agents due to their specificity and low toxicity. They are used to target a wide variety of diseases, including cancer, metabolic disorders, and infectious diseases. [2-(Fmoc-amino)acetamido]methyl Acetate is used to produce peptides that can act as hormones, vaccines, or enzyme inhibitors, offering a versatile approach for drug development. In addition to its pharmaceutical applications, [2-(Fmoc-amino)acetamido]methyl Acetate is also used in research related to protein engineering and structural biology. Researchers employ this reagent in the synthesis of peptides that are used to study protein-protein interactions, enzyme kinetics, and other biological processes. These studies help to expand our understanding of cellular mechanisms and contribute to the development of new therapeutic strategies. Furthermore, [2-(Fmoc-amino)acetamido]methyl Acetate is employed in the preparation of peptide libraries, which are collections of peptides with diverse sequences used in drug screening and discovery. This application is particularly important for identifying novel peptide-based drugs and biomarkers. The compound's stability and ease of use have made it a standard in laboratories specializing in peptide synthesis. Its role in solid-phase synthesis, where it is typically incorporated into the growing peptide chain, is integral to the development of bioactive peptides. Moreover, the ability to easily remove the Fmoc group at the end of the synthesis process facilitates the efficient production of pure peptides with minimal by-products. In conclusion, [2-(Fmoc-amino)acetamido]methyl Acetate is a vital chemical reagent in peptide chemistry, with applications spanning pharmaceuticals, biomedical research, and protein engineering. Its discovery marked a significant advancement in peptide synthesis, offering a more efficient and reliable method for producing complex peptides. With its ongoing use in drug development and molecular biology, this compound continues to play an essential role in scientific innovation. References none |
| Market Analysis Reports |