| Zhengzhou Kingorgchem Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.kingorgchem.com | |||
![]() | +86 (371) 6551-1006 | |||
![]() | +86 (371) 6575-6965 | |||
![]() | sales@kingorgchem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18625597674 | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Wu Han Taiyu Kaishang Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.taiyuchem.com | |||
![]() | +86 13657232893 | |||
![]() | 13657232893@163.com | |||
![]() | WhatsApp:+86 13657232893 | |||
| Chemical manufacturer since 2018 | ||||
| chemBlink Standard supplier since 2025 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Biphenyl compounds |
|---|---|
| Name | (SP-4-3)-[bis(1,1-dimethylethyl)[2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine](methanesulfonato-κO)[2'-(methylamino-κN)[1,1'-biphenyl]-2-yl-κC]-Palladium |
| Synonyms | (Methanesulfonato-?O)[2'-(methylamino)-2-biphenylyl]palladium - bis(2-methyl-2-propanyl)(2',4',6'-triisopropyl-2-biphenylyl)phosphine (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C43H60NO3PPdS |
| Molecular Weight | 808.40 |
| CAS Registry Number | 1599466-89-3 |
| EC Number | 813-040-6 |
| SMILES | CC(C)c1cc(c(c(c1)C(C)C)c2ccccc2P(C(C)(C)C)C(C)(C)C)C(C)C.CNc1ccccc1c2ccccc2[Pd]OS(=O)(=O)C |
| Hazard Symbols | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302-H315-H319-H335-H412 Details | ||||||||||||||||||||||||
| Safety Statements | P261-P264-P270-P271-P273-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
|
(SP-4-3)-[Bis(1,1-dimethylethyl)[2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine](methanesulfonato-κO)[2'-(methylamino-κN)[1,1'-biphenyl]-2-yl-κC]-Palladium is a specialized palladium complex that plays a significant role in modern synthetic chemistry, particularly in facilitating complex organic reactions. The development of this compound is rooted in the ongoing efforts to create highly efficient and selective catalysts that can streamline synthetic processes and enable the formation of intricate molecular structures. The structure of this palladium complex is a testament to the advanced ligand design strategies employed in modern catalysis. The palladium center is coordinated by a bis(1,1-dimethylethyl)phosphine ligand, which is substituted with a 2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl group. This bulky ligand is crucial for controlling the steric and electronic environment around the palladium center, thereby enhancing the catalyst's performance in specific reactions. The presence of the methanesulfonato ligand adds further stability and reactivity, while the 2'-(methylamino-κN)[1,1'-biphenyl]-2-yl group contributes additional coordination, ensuring the complex's overall effectiveness. The primary application of this palladium complex lies in its role as a catalyst in cross-coupling reactions, particularly in the Suzuki-Miyaura and Buchwald-Hartwig amination reactions. These reactions are fundamental in organic synthesis, allowing for the formation of carbon-carbon and carbon-nitrogen bonds, which are essential in the construction of pharmaceuticals, agrochemicals, and complex natural products. The high efficiency and selectivity of this palladium complex make it an invaluable tool in these transformations, leading to improved yields and reaction rates. Beyond cross-coupling reactions, (SP-4-3)-[Bis(1,1-dimethylethyl)[2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine](methanesulfonato-κO)[2'-(methylamino-κN)[1,1'-biphenyl]-2-yl-κC]-Palladium has shown promise in other catalytic processes, such as carbon-heteroatom bond formation and C-H activation. These reactions are of great interest due to their potential to simplify synthetic routes and increase the overall efficiency of chemical processes, making them highly attractive for industrial applications. The discovery of this palladium complex underscores the importance of ligand design in the development of new catalysts. By carefully tuning the ligands surrounding the palladium center, chemists can achieve greater control over the reactivity, selectivity, and stability of the catalyst. This has led to significant advancements in the field of catalysis, enabling the development of more efficient and sustainable chemical processes. In summary, (SP-4-3)-[Bis(1,1-dimethylethyl)[2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine](methanesulfonato-κO)[2'-(methylamino-κN)[1,1'-biphenyl]-2-yl-κC]-Palladium is a key player in the realm of catalysis, offering enhanced performance in critical organic reactions. Its design and application represent a significant step forward in the ongoing quest to develop more efficient and selective catalytic systems. References none |
| Market Analysis Reports |