Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
|
+41 (71) 858-2020 | |||
|
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
|
+44 (1457) 860-111 | |||
|
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Rare Chemicals GmbH | Germany | |||
|---|---|---|---|---|
|
+49 (431) 5606-600 | |||
|
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | Octanoic Acid 6-Chloro-1H-Indol-3-Yl Ester |
|---|---|
| Synonyms | 6-Chloro-1H-Indol-3-Yl Octanoate; 6-CHLORO-3-INDOXYL CAPRYLATE; 6-CHLORO-3-INDOXYL OCTANOATE |
| Molecular Structure |  |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 |
| CAS Registry Number | 159954-35-5 |
| SMILES | CCCCCCCC(=O)Oc1c[nH]c2c1ccc(c2)Cl |
| InChI | 1S/C16H20ClNO2/c1-2-3-4-5-6-7-16(19)20-15-11-18-14-10-12(17)8-9-13(14)15/h8-11,18H,2-7H2,1H3 |
| SDS | Available |
|---|---|
| Market Analysis Reports |