| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | Hexadecylammonium Chloride |
|---|---|
| Synonyms | Hexadecylammonium Chloride; Cetylammonium Chloride; 1-Hexadecanamine, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C16H36ClN |
| Molecular Weight | 277.92 |
| CAS Registry Number | 1602-97-7 |
| EINECS | 216-499-5 |
| SMILES | C(CCCCCCCC)CCCCCCC[NH3+].[Cl-] |
| InChI | 1S/C16H35N.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17;/h2-17H2,1H3;1H |
| InChIKey | ZWGTVKDEOPDFGW-UHFFFAOYSA-N |
| Boiling point | 321.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 140.6°C (Cal.) |
| (1) | Anca Meffre, Sébastien Lachaize, Christophe Gatel, Marc Respaud and Bruno Chaudret. Use of long chain amine as a reducing agent for the synthesis of high quality monodisperse iron(0) nanoparticles, J. Mater. Chem., 2011, 21, 13464. |
|---|---|
| Market Analysis Reports |