| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | trans-Octahydronaphthalene-2(1H)-One |
|---|---|
| Synonyms | (4Ar,8Ar)-Decalin-2-One; (4Ar,8Ar)-2-Decalinone; Nsc68515 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 |
| CAS Registry Number | 16021-08-2 |
| EINECS | 240-156-9 |
| SMILES | [C@@H]12CCC(=O)C[C@H]1CCCC2 |
| InChI | 1S/C10H16O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h8-9H,1-7H2/t8-,9-/m1/s1 |
| InChIKey | LGVJRKCQQHOWAU-RKDXNWHRSA-N |
| Density | 0.983g/cm3 (Cal.) |
|---|---|
| Boiling point | 255.006°C at 760 mmHg (Cal.) |
| Flash point | 101.667°C (Cal.) |
| (1) | Kamata et al.. Efficient stereo- and regioselective hydroxylation of alkanes catalysed by a bulky polyoxometalate, Nature Chemistry, 2010 |
|---|---|
| Market Analysis Reports |