| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1,1-Dimethylcyclopropane |
|---|---|
| Synonyms | Gem-Dimethylcyclopropane; Cyclopropane, 1,1-Dimethyl-; Inchi=1/C5h10/C1-5(2)3-4-5/H3-4H2,1-2H |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10 |
| Molecular Weight | 70.13 |
| CAS Registry Number | 1630-94-0 |
| SMILES | CC1(C)CC1 |
| InChI | 1S/C5H10/c1-5(2)3-4-5/h3-4H2,1-2H3 |
| InChIKey | PBIJFSCPEFQXBB-UHFFFAOYSA-N |
| Density | 0.765g/cm3 (Cal.) |
|---|---|
| Boiling point | 20.599°C at 760 mmHg (Cal.) |
| Flash point | -57.977°C (Cal.) |
| (1) | John D. DeSain, Stephen J. Klippenstein and Craig A. Taatjes. Time-resolved measurements of OH and HO product formation in pulsed-photolytic chlorine atom initiated oxidation of neopentane, Phys. Chem. Chem. Phys., 2003, 5, 1584. |
|---|---|
| Market Analysis Reports |