| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 2-Benzyl-Indan-1-One |
|---|---|
| Synonyms | 2-(Phenylmethyl)Indan-1-One; 2-(Phenylmethyl)-1-Indanone; 2-(Benzyl)Indan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 |
| CAS Registry Number | 16307-30-5 |
| SMILES | C2=C1C(=O)C(CC1=CC=C2)CC3=CC=CC=C3 |
| InChI | 1S/C16H14O/c17-16-14(10-12-6-2-1-3-7-12)11-13-8-4-5-9-15(13)16/h1-9,14H,10-11H2 |
| InChIKey | AKAKCEPCLVSYHK-UHFFFAOYSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.541°C at 760 mmHg (Cal.) |
| Flash point | 157.821°C (Cal.) |
| (1) | Cristina Pinedo-Rivilla, Josefina Aleu, Manuel Grande Benito and Isidro G. Collado. Biocatalytic preparation and absolute configuration of enantiomerically pure fungistatic anti-2-benzylindane derivatives. Study of the detoxification mechanism by Botrytis cinerea, Org. Biomol. Chem., 2010, 8, 3784. |
|---|---|
| Market Analysis Reports |