| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Array BioPharma Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (303) 381-6600 | |||
![]() |
info@arraybiopharma.com | |||
| Chemical manufacturer | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Manchester Organics Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| OX CHEM | USA | |||
|---|---|---|---|---|
![]() |
+1 (626) 461-2812 | |||
![]() |
sales@ox-chem.com | |||
| CRO since 2013 | ||||
| Paragos e. K. | Germany | |||
|---|---|---|---|---|
![]() |
+49 2330-8079751 | |||
![]() |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | (3,5-Dichlorophenyl)Methanesulfonyl Chloride |
|---|---|
| Synonyms | (3,5-DIchlorophenyl)-METHANESULFONYL CHLORIDE; (3,5-DICHLORO-PHENYL)-METHANESULFONYL CHLORIDE; (3,5-Dichlorophenyl)methanesulphonyl chloride |
| Molecular Formula | C7H5Cl3O2S |
| Molecular Weight | 259.54 |
| CAS Registry Number | 163295-70-3 |
| SMILES | C1=C(C=C(C=C1Cl)Cl)CS(=O)(=O)Cl |
| InChI | 1S/C7H5Cl3O2S/c8-6-1-5(2-7(9)3-6)4-13(10,11)12/h1-3H,4H2 |
| InChIKey | GZMJRPMBVICCFL-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 105-110°C (Expl.) |
| Boiling point | 350.6±32.0°C at 760 mmHg (Cal.) |
| Flash point | 165.8±25.1°C (Cal.) |
| Refractive index | 1.59 (Cal.) |
| Safety Code | S26;S36/37/39;S45 Details |
|---|---|
| Risk Code | R34 Details |
| Hazard Symbol | C Details |
| Transport Information | UN3096 |
| Safety Description | DANGER: CORROSIVE, Water reactive, burns skin and eyes. |
| DANGER: CORROSIVE, burns skin and eyes | |
| Corrosive | |
| CORROSIVE, WATER REACTIVE | |
| SDS | Available |
| Market Analysis Reports |