|
CAS#: 16354-53-3 Product: 7,12-Dimethoxybenz[a]Anthracene No suppilers available for the product. |
| Name | 7,12-Dimethoxybenz[a]Anthracene |
|---|---|
| Synonyms | 4-06-00-07000 (Beilstein Handbook Reference); 7,12-Dimethoxybenz(A)Anthracene; Brn 3390551 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 |
| CAS Registry Number | 16354-53-3 |
| SMILES | C2=CC4=C(C3=C(C1=CC=CC=C1C(=C23)OC)OC)C=CC=C4 |
| InChI | 1S/C20H16O2/c1-21-19-15-9-5-6-10-16(15)20(22-2)18-14-8-4-3-7-13(14)11-12-17(18)19/h3-12H,1-2H3 |
| InChIKey | PTYJZLYGAHHXDM-UHFFFAOYSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.357°C at 760 mmHg (Cal.) |
| Flash point | 210.059°C (Cal.) |
| (1) | Rakhi Pathak, Kantharuby Vandayar, Willem A. L. van Otterlo, Joseph P. Michael, Manuel A. Fernandes and Charles B. de Koning. The synthesis of angularly fused polyaromatic compounds by using a light-assisted, base-mediated cyclization reaction, Org. Biomol. Chem., 2004, 2, 3504. |
|---|---|
| Market Analysis Reports |