| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Pyridines | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 447-3255 | |||
![]() |
sales@pyridines.info | |||
| Chemical manufacturer | ||||
| Name | 4-(1-Naphthylvinyl)Pyridine |
|---|---|
| Synonyms | 4-(2-Naphthalen-1-Ylethenyl)Pyridine; 4-[(E)-2-(1-Naphthyl)Vinyl]Pyridine; 4-[2-(1-Naphthyl)Vinyl]Pyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H13N |
| Molecular Weight | 231.30 |
| CAS Registry Number | 16375-56-7 |
| SMILES | C1=CC=CC2=CC=CC(=C12)\C=C\C3=CC=NC=C3 |
| InChI | 1S/C17H13N/c1-2-7-17-15(4-1)5-3-6-16(17)9-8-14-10-12-18-13-11-14/h1-13H/b9-8+ |
| InChIKey | FLKDRTOVVLNOLV-CMDGGOBGSA-N |
| Density | 1.157g/cm3 (Cal.) |
|---|---|
| Melting point | 82°C (Expl.) |
| Boiling point | 409.287°C at 760 mmHg (Cal.) |
| Flash point | 182.717°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Veerasamy Sathish, Eththilu Babu, Arumugam Ramdass, Zong-Zhan Lu, Tzu-Ting Chang, Murugesan Velayudham, Pounraj Thanasekaran, Kuang-Lieh Lu, Wen-Shan Li and Seenivasan Rajagopal. Photoswitchable alkoxy-bridged binuclear rhenium(i) complexes – a potential probe for biomolecules and optical cell imaging, RSC Advances, 2013, . |
|---|---|
| Market Analysis Reports |