| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aliphatic carboxylate |
|---|---|
| Name | Geranyl Acetate |
| Synonyms | 3,7-Dimethylocta-2,6-Dienyl Acetate; Acetic Acid 3,7-Dimethylocta-2,6-Dienyl Ester; Acetic Acid [(2E)-3,7-Dimethylocta-2,6-Dienyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 |
| CAS Registry Number | 16409-44-2 |
| EINECS | 240-458-0 |
| SMILES | C(\C(=C\COC(C)=O)C)CC=C(C)C |
| InChI | 1S/C12H20O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,8H,5,7,9H2,1-4H3/b11-8+ |
| InChIKey | HIGQPQRQIQDZMP-DHZHZOJOSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| 0.91 (Expl.) | |
| Boiling point | 247.506°C at 760 mmHg (Cal.) |
| 133-135°C (Expl.) | |
| Flash point | 98.889°C (Cal.) |
| 98°C (Expl.) | |
| Refractive index | 1.459 (Expl.) |
| Safety Description | WARNING: Irritates skin and eyes |
|---|---|
| WARNING: Irritates lungs, eyes, skin | |
| CAUTION: May irritate eyes, skin, and respiratory tract | |
| SDS | Available |
| Market Analysis Reports |