| Actylis | USA | |||
|---|---|---|---|---|
![]() |
+1 (516) 627-6000 | |||
![]() |
info@actylis.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Crescent Chemical Co. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| RIA International LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (973) 581-1282/ | |||
![]() |
marketing@riausa.net,nj@riausa.net | |||
| Chemical distributor | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | API >> Antiparasitic drug >> Resistance to filariasis and anti-leishmaniasis |
|---|---|
| Name | Diethylcarbamazine Citrate |
| Synonyms | Citric Acid; N,N-Diethyl-4-Methyl-Piperazine-1-Carboxamide; Citric Acid; N,N-Diethyl-4-Methyl-1-Piperazinecarboxamide; N,N-Diethyl-4-Methyl-Piperazine-1-Carboxamide; 2-Hydroxypropane-1,2,3-Tricarboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H29N3O8 |
| Molecular Weight | 391.42 |
| CAS Registry Number | 1642-54-2 |
| EINECS | 216-696-6 |
| SMILES | C(N(C(N1CCN(C)CC1)=O)CC)C.C(C(CC(O)=O)(C(O)=O)O)C(O)=O |
| InChI | 1S/C10H21N3O.C6H8O7/c1-4-12(5-2)10(14)13-8-6-11(3)7-9-13;7-3(8)1-6(13,5(11)12)2-4(9)10/h4-9H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | PGNKBEARDDELNB-UHFFFAOYSA-N |
| Melting point | 140°C (Expl.) |
|---|---|
| Boiling point | 297.4°C at 760 mmHg (Cal.) |
| Flash point | 116.6°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |